Products 41395-10-2

CAS 41395-10-2 is the registry number for 1,3-Dimethoxy-5-propylbenzene, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1,3-dimethoxy-5-propylbenzene (CAS 41395-10-2) is a chemical compound with the molecular formula C11H16O2 and a molecular weight of 180.24 g/mol. IUPAC name: 1,3-dimethoxy-5-propylbenzene. InChIKey: UHLXFCGEIFTPSB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16O2
Molecular weight180.24 g/mol
IUPAC name1,3-dimethoxy-5-propylbenzene
InChIKeyUHLXFCGEIFTPSB-UHFFFAOYSA-N
SMILESCCCC1=CC(=CC(=C1)OC)OC

Computed by PubChem (NCBI)