Products 498542-88-4
CAS 498542-88-4 is the registry number for 1,3-Dimethoxy-5-(propyl-2,2,3,3,3-d5)benzene. Offered by: TRC. Available pack sizes: 25mg.
1,3-dimethoxy-5-(2,2,3,3,3-pentadeuteriopropyl)benzene (CAS 498542-88-4) is a chemical compound with the molecular formula C11H16O2 and a molecular weight of 185.27 g/mol. IUPAC name: 1,3-dimethoxy-5-(2,2,3,3,3-pentadeuteriopropyl)benzene. InChIKey: UHLXFCGEIFTPSB-SGEUAGPISA-N.
| Molecular formula | C11H16O2 |
|---|---|
| Molecular weight | 185.27 g/mol |
| IUPAC name | 1,3-dimethoxy-5-(2,2,3,3,3-pentadeuteriopropyl)benzene |
| InChIKey | UHLXFCGEIFTPSB-SGEUAGPISA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])CC1=CC(=CC(=C1)OC)OC |
Computed by PubChem (NCBI)