Products 41419-25-4
CAS 41419-25-4 appears in our catalog under these names: 6-Phenylpiperidin-2-one, 95%, 6-Phenylpiperidin-2-one, 98%, 6-Phenylpiperidin-2-one, 6-Phenylpiperidin-2-one 95%, 6-Phenylpiperidin-2-one, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 50mg, 0,5g.
6-phenylpiperidin-2-one (CAS 41419-25-4) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 6-phenylpiperidin-2-one. InChIKey: DVPYHFDURADIIA-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 6-phenylpiperidin-2-one |
| InChIKey | DVPYHFDURADIIA-UHFFFAOYSA-N |
| SMILES | C1CC(NC(=O)C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)