Products 4142-98-7
CAS 4142-98-7 appears in our catalog under these names: ETHYL 3,5-DIHYDROXYBENZOATE, 98%, 98%, Ethyl 3,5-dihydroxybenzoate, 98%, ETHYL 3,5-DIHYDROXYBENZOATE/ 99.59% (existing batch purity), Ethyl 3,5–dihydroxybenzoate, 3,5-Dihydroxybenzoic acid ethyl ester. Offered by: Chemat, Ambeed, Fluorochem, BLDpharm, TargetMol. Available pack sizes: 1g, 5g, 25g, 100g, 500g, 100mg, 10g, 10mM/1mL.
Ethyl 3,5-dihydroxybenzoate (CAS 4142-98-7) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: ethyl 3,5-dihydroxybenzoate. InChIKey: APHYVLPIZUVDTK-UHFFFAOYSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | ethyl 3,5-dihydroxybenzoate |
| InChIKey | APHYVLPIZUVDTK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC(=C1)O)O |
Computed by PubChem (NCBI)