CAS 41443-27-0 appears in our catalog under these names: Quinoxalin-2(1H)-one oxime, 97%, 97%, N-(quinoxalin-2-yl)hydroxylamine, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
N-quinoxalin-2-ylhydroxylamine (CAS 41443-27-0) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: N-quinoxalin-2-ylhydroxylamine. InChIKey: KBYDXHIOJFHUOS-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | N-quinoxalin-2-ylhydroxylamine |
| InChIKey | KBYDXHIOJFHUOS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CC(=N2)NO |
Computed by PubChem (NCBI)