Products 41486-92-4
CAS 41486-92-4 is the registry number for H-D-Met(O2)-OH. Offered by: Biosynth. Available pack sizes: 2000mg, 5000mg, 10000mg.
(2R)-2-amino-4-methylsulfonylbutanoic acid (CAS 41486-92-4) is a chemical compound with the molecular formula C5H11NO4S and a molecular weight of 181.21 g/mol. IUPAC name: (2R)-2-amino-4-methylsulfonylbutanoic acid. InChIKey: UCUNFLYVYCGDHP-SCSAIBSYSA-N.
| Molecular formula | C5H11NO4S |
|---|---|
| Molecular weight | 181.21 g/mol |
| IUPAC name | (2R)-2-amino-4-methylsulfonylbutanoic acid |
| InChIKey | UCUNFLYVYCGDHP-SCSAIBSYSA-N |
| SMILES | CS(=O)(=O)CC[C@H](C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
d-methionine sulfone, Methionine sulfone, D-, D-Methionine, S,S-dioxide, (R)-4-(Methylsulfonyl)-2-aminobutanoic acid, H-D-Met(O2)-OH, (R)-2-Amino-4-(methylsulfonyl)butanoic acid, (2R)-2-amino-4-methylsulfonylbutanoic acid, (2R)-2-amino-4-methanesulfonylbutanoic acid, (2R)-2-azaniumyl-4-methylsulfonylbutanoate, H-D-Met(O)-OH