CAS 415678-34-1 is the registry number for Rel-(2R,5R)-5-benzyl-2-(tert-butyl)-3-methylimidazolidin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,5R)-5-benzyl-2-tert-butyl-3-methylimidazolidin-4-one (CAS 415678-34-1) is a chemical compound with the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. IUPAC name: (2R,5R)-5-benzyl-2-tert-butyl-3-methylimidazolidin-4-one. InChIKey: SKHPYKHVYFTIOI-TZMCWYRMSA-N.
| Molecular formula | C15H22N2O |
|---|---|
| Molecular weight | 246.35 g/mol |
| IUPAC name | (2R,5R)-5-benzyl-2-tert-butyl-3-methylimidazolidin-4-one |
| InChIKey | SKHPYKHVYFTIOI-TZMCWYRMSA-N |
| SMILES | CC(C)(C)[C@@H]1N[C@@H](C(=O)N1C)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)