CAS 916152-80-2 is the registry number for (2S,5R)-5-Benzyl-2-(tert-butyl)-3-methylimidazolidin-4-one, 98% 99%ee. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2S,5R)-5-benzyl-2-tert-butyl-3-methylimidazolidin-4-one (CAS 916152-80-2) is a chemical compound with the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. IUPAC name: (2S,5R)-5-benzyl-2-tert-butyl-3-methylimidazolidin-4-one. InChIKey: SKHPYKHVYFTIOI-OCCSQVGLSA-N.
| Molecular formula | C15H22N2O |
|---|---|
| Molecular weight | 246.35 g/mol |
| IUPAC name | (2S,5R)-5-benzyl-2-tert-butyl-3-methylimidazolidin-4-one |
| InChIKey | SKHPYKHVYFTIOI-OCCSQVGLSA-N |
| SMILES | CC(C)(C)[C@H]1N[C@@H](C(=O)N1C)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)