Products 415678-56-7
CAS 415678-56-7 is the registry number for (2R,5S)-5-Benzyl-3-methyl-2-(5-methylfuran-2-yl)imidazolidin-4-one, 98%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
(2R,5S)-5-benzyl-3-methyl-2-(5-methylfuran-2-yl)imidazolidin-4-one (CAS 415678-56-7) is a chemical compound with the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. IUPAC name: (2R,5S)-5-benzyl-3-methyl-2-(5-methylfuran-2-yl)imidazolidin-4-one. InChIKey: IQIMPHPFMHVWBZ-DZGCQCFKSA-N.
| Molecular formula | C16H18N2O2 |
|---|---|
| Molecular weight | 270.33 g/mol |
| IUPAC name | (2R,5S)-5-benzyl-3-methyl-2-(5-methylfuran-2-yl)imidazolidin-4-one |
| InChIKey | IQIMPHPFMHVWBZ-DZGCQCFKSA-N |
| SMILES | CC1=CC=C(O1)[C@@H]2N[C@H](C(=O)N2C)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)