CAS 415963-95-0 is the registry number for OXTR modulator-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(N-(4-ethoxyphenyl)sulfonylanilino)-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide (CAS 415963-95-0) is a chemical compound with the molecular formula C24H22N4O5S and a molecular weight of 478.5 g/mol. IUPAC name: 2-(N-(4-ethoxyphenyl)sulfonylanilino)-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide. InChIKey: SWSSHGSRPZMMDM-UHFFFAOYSA-N.
| Molecular formula | C24H22N4O5S |
|---|---|
| Molecular weight | 478.5 g/mol |
| IUPAC name | 2-(N-(4-ethoxyphenyl)sulfonylanilino)-N-[(2-hydroxy-1H-indol-3-yl)imino]acetamide |
| InChIKey | SWSSHGSRPZMMDM-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)S(=O)(=O)N(CC(=O)N=NC2=C(NC3=CC=CC=C32)O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)