CAS 752187-80-7 appears in our catalog under these names: Taprenepag/ 99.32% (existing batch purity), Taprenepag (CP–544326), Taprenepag, Taprenepag, 98%, 98%, Taprenepag, 98.79%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
2-[3-[[(4-pyrazol-1-ylphenyl)methyl-pyridin-3-ylsulfonylamino]methyl]phenoxy]acetic acid (CAS 752187-80-7) is a chemical compound with the molecular formula C24H22N4O5S and a molecular weight of 478.5 g/mol. IUPAC name: 2-[3-[[(4-pyrazol-1-ylphenyl)methyl-pyridin-3-ylsulfonylamino]methyl]phenoxy]acetic acid. InChIKey: MFFBXYNKZHTCEY-UHFFFAOYSA-N.
| Molecular formula | C24H22N4O5S |
|---|---|
| Molecular weight | 478.5 g/mol |
| IUPAC name | 2-[3-[[(4-pyrazol-1-ylphenyl)methyl-pyridin-3-ylsulfonylamino]methyl]phenoxy]acetic acid |
| InChIKey | MFFBXYNKZHTCEY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(=O)O)CN(CC2=CC=C(C=C2)N3C=CC=N3)S(=O)(=O)C4=CN=CC=C4 |
Computed by PubChem (NCBI)