Products 4160-92-3
CAS 4160-92-3 is the registry number for 3-Methyl-3-phenylpentanedioic acid. Offered by: Biosynth. Available pack sizes: 250mg.
3-methyl-3-phenylpentanedioic acid (CAS 4160-92-3) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 3-methyl-3-phenylpentanedioic acid. InChIKey: LEHVKCUBJITYCL-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 3-methyl-3-phenylpentanedioic acid |
| InChIKey | LEHVKCUBJITYCL-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)O)(CC(=O)O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)
Synonyms:
3-methyl-3-phenylpentanedioic acid, 3-Methyl-3-phenylglutaric acid, Pentanedioic acid, 3-methyl-3-phenyl-, 3-methyl-3-phenylpentanedioicacid, Glutaric acid, 3-methyl-3-phenyl-, 3-Methyl-3-phenyl-pentanedioic acid, NCIStruc1_000621, NCIStruc2_000545, 3-methyl-3-phenyl-glutaric acid, LEHVKCUBJITYCL-UHFFFAOYSA-N