CAS 41616-02-8 is the registry number for 5-Amino-n,n'-dimethylisophthalamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-amino-1-N,3-N-dimethylbenzene-1,3-dicarboxamide (CAS 41616-02-8) is a chemical compound with the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. IUPAC name: 5-amino-1-N,3-N-dimethylbenzene-1,3-dicarboxamide. InChIKey: OUAGKUUKYRRPLE-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O2 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 5-amino-1-N,3-N-dimethylbenzene-1,3-dicarboxamide |
| InChIKey | OUAGKUUKYRRPLE-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=CC(=C1)N)C(=O)NC |
Computed by PubChem (NCBI)