CAS 41621-49-2 appears in our catalog under these names: Ciclopirox Olamine, Ciclopirox Ethanolamine, >95% (HPLC), Ciclopirox olamine/ 98.97% (existing batch purity), Ciclopirox ethanolamine, Ciclopirox olamine, 98.00%. Offered by: Chemat Brand, TRC, Mikromol, LoGiCal, TargetMol. Available pack sizes: on request, 500mg, 50mg, 5g, 250mg, 10mg, 25mg, 100mg.
2-aminoethanol;6-cyclohexyl-1-hydroxy-4-methylpyridin-2-one (CAS 41621-49-2) is a chemical compound with the molecular formula C14H24N2O3 and a molecular weight of 268.35 g/mol. IUPAC name: 2-aminoethanol;6-cyclohexyl-1-hydroxy-4-methylpyridin-2-one. InChIKey: MBRHNTMUYWQHMR-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O3 |
|---|---|
| Molecular weight | 268.35 g/mol |
| IUPAC name | 2-aminoethanol;6-cyclohexyl-1-hydroxy-4-methylpyridin-2-one |
| InChIKey | MBRHNTMUYWQHMR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N(C(=C1)C2CCCCC2)O.C(CO)N |
Computed by PubChem (NCBI)