CAS 4173-84-6 appears in our catalog under these names: (4-Acetamidophenyl)acetone, 95%, (4-Acetamidophenyl)acetone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g.
N-[4-(2-oxopropyl)phenyl]acetamide (CAS 4173-84-6) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: N-[4-(2-oxopropyl)phenyl]acetamide. InChIKey: OGUNIWZCURZHQF-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | N-[4-(2-oxopropyl)phenyl]acetamide |
| InChIKey | OGUNIWZCURZHQF-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=CC=C(C=C1)NC(=O)C |
Computed by PubChem (NCBI)