Products 4191-07-5
CAS 4191-07-5 is the registry number for 1,4-Bis(4-acetylphenyl)benzene, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[4-[4-(4-acetylphenyl)phenyl]phenyl]ethanone (CAS 4191-07-5) is a chemical compound with the molecular formula C22H18O2 and a molecular weight of 314.4 g/mol. IUPAC name: 1-[4-[4-(4-acetylphenyl)phenyl]phenyl]ethanone. InChIKey: LSRWKYYPPBDFRR-UHFFFAOYSA-N.
| Molecular formula | C22H18O2 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | 1-[4-[4-(4-acetylphenyl)phenyl]phenyl]ethanone |
| InChIKey | LSRWKYYPPBDFRR-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)C(=O)C |
Computed by PubChem (NCBI)