Products 4195-17-9
CAS 4195-17-9 appears in our catalog under these names: 4-Nitrophenyl trimethylacetate, 95%, 4-Nitrophenyl trimethylacetate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 25g, 1g.
(4-nitrophenyl) 2,2-dimethylpropanoate (CAS 4195-17-9) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: (4-nitrophenyl) 2,2-dimethylpropanoate. InChIKey: QADVJDGFQGNSIF-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | (4-nitrophenyl) 2,2-dimethylpropanoate |
| InChIKey | QADVJDGFQGNSIF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
4-Nitrophenyl trimethylacetate, 4-nitrophenyl 2,2-dimethylpropanoate, Para-nitrophenyl pivalate, 4-Nitrophenyl pivalate, (4-nitrophenyl) 2,2-dimethylpropanoate, Propanoic acid, 2,2-dimethyl-, 4-nitrophenyl ester, 4-Nitrophenylpivalate, 4-Nitrophenyl pivalate #, p-nitrophenyl trimethylacetate, QADVJDGFQGNSIF-UHFFFAOYSA-