CAS 419557-41-8 is the registry number for 2-(3-Chlorophenyl)-6-methylimidazo[1,2-a]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-chlorophenyl)-6-methylimidazo[1,2-a]pyridine (CAS 419557-41-8) is a chemical compound with the molecular formula C14H11ClN2 and a molecular weight of 242.70 g/mol. IUPAC name: 2-(3-chlorophenyl)-6-methylimidazo[1,2-a]pyridine. InChIKey: AFAFENGOVTUNMP-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 2-(3-chlorophenyl)-6-methylimidazo[1,2-a]pyridine |
| InChIKey | AFAFENGOVTUNMP-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=C(N=C2C=C1)C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)