CAS 42056-77-9 is the registry number for (4-(4-bromophenyl)(2,5-thiazolyl))phenylamine. Offered by: Biosynth. Available pack sizes: 5000mg.
4-(4-bromophenyl)-N-phenyl-1,3-thiazol-2-amine (CAS 42056-77-9) is a chemical compound with the molecular formula C15H11BrN2S and a molecular weight of 331.2 g/mol. IUPAC name: 4-(4-bromophenyl)-N-phenyl-1,3-thiazol-2-amine. InChIKey: WSEYNFJNIBSAIT-UHFFFAOYSA-N.
| Molecular formula | C15H11BrN2S |
|---|---|
| Molecular weight | 331.2 g/mol |
| IUPAC name | 4-(4-bromophenyl)-N-phenyl-1,3-thiazol-2-amine |
| InChIKey | WSEYNFJNIBSAIT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC(=CS2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)