CAS 676348-26-8 is the registry number for 4-(4'-Bromo-(1,1'-biphenyl)-4-yl)thiazol-2-amine, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
4-[4-(4-bromophenyl)phenyl]-1,3-thiazol-2-amine (CAS 676348-26-8) is a chemical compound with the molecular formula C15H11BrN2S and a molecular weight of 331.2 g/mol. IUPAC name: 4-[4-(4-bromophenyl)phenyl]-1,3-thiazol-2-amine. InChIKey: LOWLBQYVCRNFPN-UHFFFAOYSA-N.
| Molecular formula | C15H11BrN2S |
|---|---|
| Molecular weight | 331.2 g/mol |
| IUPAC name | 4-[4-(4-bromophenyl)phenyl]-1,3-thiazol-2-amine |
| InChIKey | LOWLBQYVCRNFPN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)Br)C3=CSC(=N3)N |
Computed by PubChem (NCBI)