CAS 42059-80-3 appears in our catalog under these names: 3-Formyl-6-nitrochromone, 3-FORMYL-6-NITROCHROMONE, 99%, 3-Formyl-6-nitrochromone, 94%, 6-Nitro-4-oxo-4h-chromene-3-carbaldehyde, 98%, 6-Nitro-4-oxo-4H-chromene-3-carbaldehyde 94%. Offered by: Biosynth, Sigma-Aldrich, Fluorochem, Combi-blocks, Ambeed. Available pack sizes: 2g, 5g, 10g, 25g, 1G, 250mg.
6-nitro-4-oxochromene-3-carbaldehyde (CAS 42059-80-3) is a chemical compound with the molecular formula C10H5NO5 and a molecular weight of 219.15 g/mol. IUPAC name: 6-nitro-4-oxochromene-3-carbaldehyde. InChIKey: JBDRQGWTNRIJRV-UHFFFAOYSA-N.
| Molecular formula | C10H5NO5 |
|---|---|
| Molecular weight | 219.15 g/mol |
| IUPAC name | 6-nitro-4-oxochromene-3-carbaldehyde |
| InChIKey | JBDRQGWTNRIJRV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=O)C(=CO2)C=O |
Computed by PubChem (NCBI)