CAS 54808-30-9 is the registry number for 2-Hydroxy-3-nitronaphthalene-1,4-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-hydroxy-3-nitronaphthalene-1,2-dione (CAS 54808-30-9) is a chemical compound with the molecular formula C10H5NO5 and a molecular weight of 219.15 g/mol. IUPAC name: 4-hydroxy-3-nitronaphthalene-1,2-dione. InChIKey: RVBGMGMJKICXMH-UHFFFAOYSA-N.
| Molecular formula | C10H5NO5 |
|---|---|
| Molecular weight | 219.15 g/mol |
| IUPAC name | 4-hydroxy-3-nitronaphthalene-1,2-dione |
| InChIKey | RVBGMGMJKICXMH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C(=O)C2=O)[N+](=O)[O-])O |
Computed by PubChem (NCBI)