CAS 420825-19-0 is the registry number for 1-(5-Chloro-2-hydroxyphenyl)-3-(3-methylphenyl)propane-1,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(5-chloro-2-hydroxyphenyl)-3-(3-methylphenyl)propane-1,3-dione (CAS 420825-19-0) is a chemical compound with the molecular formula C16H13ClO3 and a molecular weight of 288.72 g/mol. IUPAC name: 1-(5-chloro-2-hydroxyphenyl)-3-(3-methylphenyl)propane-1,3-dione. InChIKey: GVPDHEGDQSUGKQ-UHFFFAOYSA-N.
| Molecular formula | C16H13ClO3 |
|---|---|
| Molecular weight | 288.72 g/mol |
| IUPAC name | 1-(5-chloro-2-hydroxyphenyl)-3-(3-methylphenyl)propane-1,3-dione |
| InChIKey | GVPDHEGDQSUGKQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)CC(=O)C2=C(C=CC(=C2)Cl)O |
Computed by PubChem (NCBI)