Products 879642-82-7
CAS 879642-82-7 is the registry number for (2E)-3-(4-[(4-Chlorobenzyl)oxy]phenyl)acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(E)-3-[4-[(4-chlorophenyl)methoxy]phenyl]prop-2-enoic acid (CAS 879642-82-7) is a chemical compound with the molecular formula C16H13ClO3 and a molecular weight of 288.72 g/mol. IUPAC name: (E)-3-[4-[(4-chlorophenyl)methoxy]phenyl]prop-2-enoic acid. InChIKey: IRCGUVJWCKSXHE-BJMVGYQFSA-N.
| Molecular formula | C16H13ClO3 |
|---|---|
| Molecular weight | 288.72 g/mol |
| IUPAC name | (E)-3-[4-[(4-chlorophenyl)methoxy]phenyl]prop-2-enoic acid |
| InChIKey | IRCGUVJWCKSXHE-BJMVGYQFSA-N |
| SMILES | C1=CC(=CC=C1COC2=CC=C(C=C2)/C=C/C(=O)O)Cl |
Computed by PubChem (NCBI)