CAS 42108-38-3 appears in our catalog under these names: N,N'-Dimethyl-N'-phenylacetohydrazide, 95%, N,N'-Dimethyl-N'-phenylacetohydrazide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
N,N'-dimethyl-N'-phenylacetohydrazide (CAS 42108-38-3) is a chemical compound with the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. IUPAC name: N,N'-dimethyl-N'-phenylacetohydrazide. InChIKey: USQXDQIGDMWPML-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | N,N'-dimethyl-N'-phenylacetohydrazide |
| InChIKey | USQXDQIGDMWPML-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C)N(C)C1=CC=CC=C1 |
Computed by PubChem (NCBI)