Products 42116-44-9
CAS 42116-44-9 appears in our catalog under these names: tert-Butyl benzylcarbamate, 98%, tert-Butyl N-benzylcarbamate, tert-Butyl Benzylcarbamate, >98.0%(GC), N-Boc benzylamine 95%, N-Boc benzylamine, 98%, 98%. Offered by: Combi-blocks, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 100g, 1g, 500g, 5g, 25g, 0,25g, 2,5g, 50g.
Tert-butyl N-benzylcarbamate (CAS 42116-44-9) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. IUPAC name: tert-butyl N-benzylcarbamate. InChIKey: FWOBBEOKTITUHK-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | tert-butyl N-benzylcarbamate |
| InChIKey | FWOBBEOKTITUHK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC=CC=C1 |
Computed by PubChem (NCBI)