Products 42126-21-6
CAS 42126-21-6 appears in our catalog under these names: Triethyl 1-oxopropane-1,2,3-tricarboxylate, 95-<97%, Triethyl 1-oxopropane-1,2,3-tricarboxylate, 95%, Triethyl 1-Oxopropane-1,2,3-tricarboxylate, >95%. Offered by: Hoffman Fine Chemicals, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 100mg, 250mg.
Triethyl 1-oxopropane-1,2,3-tricarboxylate (CAS 42126-21-6) is a chemical compound with the molecular formula C12H18O7 and a molecular weight of 274.27 g/mol. IUPAC name: triethyl 1-oxopropane-1,2,3-tricarboxylate. InChIKey: QQVOSUPWYRHKJF-UHFFFAOYSA-N.
| Molecular formula | C12H18O7 |
|---|---|
| Molecular weight | 274.27 g/mol |
| IUPAC name | triethyl 1-oxopropane-1,2,3-tricarboxylate |
| InChIKey | QQVOSUPWYRHKJF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C(=O)C(=O)OCC)C(=O)OCC |
Computed by PubChem (NCBI)