CAS 89063-61-6 is the registry number for 1,3,4-Tri-O-acetyl-2,6-dideoxy-D-glucopyranose. Offered by: Chemat. Available pack sizes: 100mg, 10mg, 25mg, 50mg.
[(2R,3R,4R)-3,6-diacetyloxy-2-methyloxan-4-yl] acetate (CAS 89063-61-6) is a chemical compound with the molecular formula C12H18O7 and a molecular weight of 274.27 g/mol. IUPAC name: [(2R,3R,4R)-3,6-diacetyloxy-2-methyloxan-4-yl] acetate. InChIKey: QKPIXQGRPBEVLX-RCZOMOOESA-N.
| Molecular formula | C12H18O7 |
|---|---|
| Molecular weight | 274.27 g/mol |
| IUPAC name | [(2R,3R,4R)-3,6-diacetyloxy-2-methyloxan-4-yl] acetate |
| InChIKey | QKPIXQGRPBEVLX-RCZOMOOESA-N |
| SMILES | C[C@@H]1[C@H]([C@@H](CC(O1)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)