CAS 42142-70-1 appears in our catalog under these names: 4-(6-Nitro-2-oxo-1,3-benzoxazol-3(2h)-yl)butanoic acid, 95%, 4-(6-Nitro-2-oxobenzo(d)oxazol-3(2H)-yl)butanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoic acid (CAS 42142-70-1) is a chemical compound with the molecular formula C11H10N2O6 and a molecular weight of 266.21 g/mol. IUPAC name: 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoic acid. InChIKey: HSELHMHPLWKBID-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O6 |
|---|---|
| Molecular weight | 266.21 g/mol |
| IUPAC name | 4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanoic acid |
| InChIKey | HSELHMHPLWKBID-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])OC(=O)N2CCCC(=O)O |
Computed by PubChem (NCBI)