CAS 55750-62-4 appears in our catalog under these names: 3-Maleimidopropionic Acid N-Succinimidyl Ester, >95% (HPLC), BMPS, Mal-beta-Ala-OSu, 3-Maleimidopropionic acid N-hydroxysuccinimide ester, 99% , N-Succinimidyl 3-Maleimidopropionate [Cross-linking Reagent], >98.0%(HPLC)(N). Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 10g, 5g, 1g, 100mg, 500mg, 250mg, 25g, 50g.
(2,5-dioxopyrrolidin-1-yl) 3-(2,5-dioxopyrrol-1-yl)propanoate (CAS 55750-62-4) is a chemical compound with the molecular formula C11H10N2O6 and a molecular weight of 266.21 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-(2,5-dioxopyrrol-1-yl)propanoate. InChIKey: JKHVDAUOODACDU-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O6 |
|---|---|
| Molecular weight | 266.21 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-(2,5-dioxopyrrol-1-yl)propanoate |
| InChIKey | JKHVDAUOODACDU-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)