Products 42174-49-2
CAS 42174-49-2 is the registry number for 3-(2,4-Dichlorophenyl)-N,N-diethylacrylamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,4-dichlorophenyl)-N,N-diethylprop-2-enamide (CAS 42174-49-2) is a chemical compound with the molecular formula C13H15Cl2NO and a molecular weight of 272.17 g/mol. IUPAC name: 3-(2,4-dichlorophenyl)-N,N-diethylprop-2-enamide. InChIKey: NKUKGTKRRRAUQC-UHFFFAOYSA-N.
| Molecular formula | C13H15Cl2NO |
|---|---|
| Molecular weight | 272.17 g/mol |
| IUPAC name | 3-(2,4-dichlorophenyl)-N,N-diethylprop-2-enamide |
| InChIKey | NKUKGTKRRRAUQC-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C=CC1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)