Products 2703781-55-7
CAS 2703781-55-7 is the registry number for (5-(3,4-Dichlorophenyl)-3-azabicyclo[3.1.1]heptan-1-yl)methanol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[5-(3,4-dichlorophenyl)-3-azabicyclo[3.1.1]heptan-1-yl]methanol (CAS 2703781-55-7) is a chemical compound with the molecular formula C13H15Cl2NO and a molecular weight of 272.17 g/mol. IUPAC name: [5-(3,4-dichlorophenyl)-3-azabicyclo[3.1.1]heptan-1-yl]methanol. InChIKey: IRZORBFVLOEHFY-UHFFFAOYSA-N.
| Molecular formula | C13H15Cl2NO |
|---|---|
| Molecular weight | 272.17 g/mol |
| IUPAC name | [5-(3,4-dichlorophenyl)-3-azabicyclo[3.1.1]heptan-1-yl]methanol |
| InChIKey | IRZORBFVLOEHFY-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(CNC2)C3=CC(=C(C=C3)Cl)Cl)CO |
Computed by PubChem (NCBI)