CAS 200709-97-3 appears in our catalog under these names: MJC13, 95%, MJC13. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
N-(2,3-dichlorophenyl)cyclohexanecarboxamide (CAS 200709-97-3) is a chemical compound with the molecular formula C13H15Cl2NO and a molecular weight of 272.17 g/mol. IUPAC name: N-(2,3-dichlorophenyl)cyclohexanecarboxamide. InChIKey: ZYPWKRVXNGLEMU-UHFFFAOYSA-N.
| Molecular formula | C13H15Cl2NO |
|---|---|
| Molecular weight | 272.17 g/mol |
| IUPAC name | N-(2,3-dichlorophenyl)cyclohexanecarboxamide |
| InChIKey | ZYPWKRVXNGLEMU-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(=O)NC2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)