CAS 42191-49-1 is the registry number for 2-(3,4-Dimethylphenyl)-N-hydroxyacetimidamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,4-dimethylphenyl)-N'-hydroxyethanimidamide (CAS 42191-49-1) is a chemical compound with the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. IUPAC name: 2-(3,4-dimethylphenyl)-N'-hydroxyethanimidamide. InChIKey: MVLKLXBWBVCXKV-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 2-(3,4-dimethylphenyl)-N'-hydroxyethanimidamide |
| InChIKey | MVLKLXBWBVCXKV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CC(=NO)N)C |
Computed by PubChem (NCBI)