Products 422324-35-4
CAS 422324-35-4 appears in our catalog under these names: (R)-tert-Butyl 2,5-diamino-5-oxopentanoate hydrochloride, 98%, 98%, tert-Butyl D-glutaminate hydrochloride, 98%, H-D-Gln-OtBu.HCl, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
Tert-butyl (2R)-2,5-diamino-5-oxopentanoate;hydrochloride (CAS 422324-35-4) is a chemical compound with the molecular formula C9H19ClN2O3 and a molecular weight of 238.71 g/mol. IUPAC name: tert-butyl (2R)-2,5-diamino-5-oxopentanoate;hydrochloride. InChIKey: ZEPNUNKDKQACNC-FYZOBXCZSA-N.
| Molecular formula | C9H19ClN2O3 |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | tert-butyl (2R)-2,5-diamino-5-oxopentanoate;hydrochloride |
| InChIKey | ZEPNUNKDKQACNC-FYZOBXCZSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H](CCC(=O)N)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
D-Glutamine tert-Butyl Ester Hydrochloride, (R)-tert-Butyl 2,5-diamino-5-oxopentanoate hydrochloride, Tert-butyl D-glutaminate hydrochloride, D-Glutaminetert-ButylEsterHydrochloride, tert-Butyl (2R)-2,5-diamino-5-oxo-pentanoate hydrochloride, Tert-butyl (2R)-2,5-diamino-5-oxopentanoate;hydrochloride, H-D-GLN-OTBU HCL, H-D-Gln-OtBu.HCl, tert-butyl (2R)-2,5-diamino-5-oxo-pentanoate;hydrochloride, D-Glutamine tert-Butyl Ester HCl