CAS 4224-84-4 is the registry number for hCAIX/XII-IN-12. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-acetyl-6-bromo-4-hydroxychromen-2-one (CAS 4224-84-4) is a chemical compound with the molecular formula C11H7BrO4 and a molecular weight of 283.07 g/mol. IUPAC name: 3-acetyl-6-bromo-4-hydroxychromen-2-one. InChIKey: CZVCQXLWYJTEDA-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO4 |
|---|---|
| Molecular weight | 283.07 g/mol |
| IUPAC name | 3-acetyl-6-bromo-4-hydroxychromen-2-one |
| InChIKey | CZVCQXLWYJTEDA-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C2=C(C=CC(=C2)Br)OC1=O)O |
Computed by PubChem (NCBI)