CAS 773109-55-0 appears in our catalog under these names: UBP714, 95%, 6-Bromo-4-methyl-2-oxo-2H-chromene-3-carboxylic acid, UBP714. Offered by: AmBeed, Biosynth, MedChemExpress. Available pack sizes: 1g, 50mg, 0,5g, 10 mg, 25 mg, 5 mg, 50 mg.
6-bromo-4-methyl-2-oxochromene-3-carboxylic acid (CAS 773109-55-0) is a chemical compound with the molecular formula C11H7BrO4 and a molecular weight of 283.07 g/mol. IUPAC name: 6-bromo-4-methyl-2-oxochromene-3-carboxylic acid. InChIKey: BWBWVUJRXNIUMA-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO4 |
|---|---|
| Molecular weight | 283.07 g/mol |
| IUPAC name | 6-bromo-4-methyl-2-oxochromene-3-carboxylic acid |
| InChIKey | BWBWVUJRXNIUMA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=C1C=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)