CAS 42272-79-7 is the registry number for (1E)-3,4-Dihydrophenazin-1(2h)-one oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(NE)-N-(3,4-dihydro-2H-phenazin-1-ylidene)hydroxylamine (CAS 42272-79-7) is a chemical compound with the molecular formula C12H11N3O and a molecular weight of 213.23 g/mol. IUPAC name: (NE)-N-(3,4-dihydro-2H-phenazin-1-ylidene)hydroxylamine. InChIKey: VTRYAOQPGFWWRM-RVDMUPIBSA-N.
| Molecular formula | C12H11N3O |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | (NE)-N-(3,4-dihydro-2H-phenazin-1-ylidene)hydroxylamine |
| InChIKey | VTRYAOQPGFWWRM-RVDMUPIBSA-N |
| SMILES | C1CC2=NC3=CC=CC=C3N=C2/C(=N/O)/C1 |
Computed by PubChem (NCBI)