Products 42276-10-8

CAS 42276-10-8 is the registry number for 2-Chloro-n-(2-methylbutan-2-yl)propanamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-chloro-N-(2-methylbutan-2-yl)propanamide (CAS 42276-10-8) is a chemical compound with the molecular formula C8H16ClNO and a molecular weight of 177.67 g/mol. IUPAC name: 2-chloro-N-(2-methylbutan-2-yl)propanamide. InChIKey: HPEFGDWNJFYURQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16ClNO
Molecular weight177.67 g/mol
IUPAC name2-chloro-N-(2-methylbutan-2-yl)propanamide
InChIKeyHPEFGDWNJFYURQ-UHFFFAOYSA-N
SMILESCCC(C)(C)NC(=O)C(C)Cl

Computed by PubChem (NCBI)