Products 42287-85-4
CAS 42287-85-4 is the registry number for Ethyl 7H-perfluoroheptanoate, 97%. Offered by: Fluorochem. Available pack sizes: 1g.
Ethyl 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoate (CAS 42287-85-4) is a chemical compound with the molecular formula C9H6F12O2 and a molecular weight of 374.12 g/mol. IUPAC name: ethyl 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoate. InChIKey: RSWKGRCCLAUGLO-UHFFFAOYSA-N.
| Molecular formula | C9H6F12O2 |
|---|---|
| Molecular weight | 374.12 g/mol |
| IUPAC name | ethyl 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanoate |
| InChIKey | RSWKGRCCLAUGLO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)