CAS 54912-87-7 is the registry number for 1,1,1,7,7,7-hexafluoro-2,6-bis(trifluoromethyl)hept-3-ene-2,6-diol. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-1,1,1,7,7,7-hexafluoro-2,6-bis(trifluoromethyl)hept-3-ene-2,6-diol (CAS 54912-87-7) is a chemical compound with the molecular formula C9H6F12O2 and a molecular weight of 374.12 g/mol. IUPAC name: (E)-1,1,1,7,7,7-hexafluoro-2,6-bis(trifluoromethyl)hept-3-ene-2,6-diol. InChIKey: VAKDPITXIDWRMQ-OWOJBTEDSA-N.
| Molecular formula | C9H6F12O2 |
|---|---|
| Molecular weight | 374.12 g/mol |
| IUPAC name | (E)-1,1,1,7,7,7-hexafluoro-2,6-bis(trifluoromethyl)hept-3-ene-2,6-diol |
| InChIKey | VAKDPITXIDWRMQ-OWOJBTEDSA-N |
| SMILES | C(/C=C/C(C(F)(F)F)(C(F)(F)F)O)C(C(F)(F)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)