CAS 4236-05-9 appears in our catalog under these names: 1–Bromo–4–nitronaphthalene, 1-Bromo-4-nitronaphthalene 96%, 1-Bromo-4-nitronaphthalene, 96%, 96%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
1-bromo-4-nitronaphthalene (CAS 4236-05-9) is a chemical compound with the molecular formula C10H6BrNO2 and a molecular weight of 252.06 g/mol. IUPAC name: 1-bromo-4-nitronaphthalene. InChIKey: OUENKLKXUFZIPK-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO2 |
|---|---|
| Molecular weight | 252.06 g/mol |
| IUPAC name | 1-bromo-4-nitronaphthalene |
| InChIKey | OUENKLKXUFZIPK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)