CAS 423768-49-4 appears in our catalog under these names: 1-(4-Fluorophenyl)-5-methyl-1h-pyrazole-4-carbonyl chloride, 95%, 1-(4-Fluorophenyl)-5-methyl-1H-pyrazole-4-carbonyl chloride, 97% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 1g, 250mg, 5g.
1-(4-fluorophenyl)-5-methylpyrazole-4-carbonyl chloride (CAS 423768-49-4) is a chemical compound with the molecular formula C11H8ClFN2O and a molecular weight of 238.64 g/mol. IUPAC name: 1-(4-fluorophenyl)-5-methylpyrazole-4-carbonyl chloride. InChIKey: INIAJXQDJISNJB-UHFFFAOYSA-N.
| Molecular formula | C11H8ClFN2O |
|---|---|
| Molecular weight | 238.64 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-5-methylpyrazole-4-carbonyl chloride |
| InChIKey | INIAJXQDJISNJB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C2=CC=C(C=C2)F)C(=O)Cl |
Computed by PubChem (NCBI)