CAS 81560-11-4 appears in our catalog under these names: 4-(Benzyloxy)-2-chloro-5-fluoropyrimidine, 95%, Pyrimidine, 2-chloro-5-fluoro-4-(phenylmethoxy)-, 98%. Offered by: Fluorochem, AmBeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-chloro-5-fluoro-4-phenylmethoxypyrimidine (CAS 81560-11-4) is a chemical compound with the molecular formula C11H8ClFN2O and a molecular weight of 238.64 g/mol. IUPAC name: 2-chloro-5-fluoro-4-phenylmethoxypyrimidine. InChIKey: PUDYTJUESWMUAJ-UHFFFAOYSA-N.
| Molecular formula | C11H8ClFN2O |
|---|---|
| Molecular weight | 238.64 g/mol |
| IUPAC name | 2-chloro-5-fluoro-4-phenylmethoxypyrimidine |
| InChIKey | PUDYTJUESWMUAJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=NC(=NC=C2F)Cl |
Computed by PubChem (NCBI)