CAS 42382-37-6 is the registry number for 4,8-Dibromo-1-naphthoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,8-dibromonaphthalene-1-carboxylic acid (CAS 42382-37-6) is a chemical compound with the molecular formula C11H6Br2O2 and a molecular weight of 329.97 g/mol. IUPAC name: 4,8-dibromonaphthalene-1-carboxylic acid. InChIKey: RISDXHGWPOMCET-UHFFFAOYSA-N.
| Molecular formula | C11H6Br2O2 |
|---|---|
| Molecular weight | 329.97 g/mol |
| IUPAC name | 4,8-dibromonaphthalene-1-carboxylic acid |
| InChIKey | RISDXHGWPOMCET-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2C(=C1)Br)C(=O)O)Br |
Computed by PubChem (NCBI)