Products 42382-37-6

CAS 42382-37-6 is the registry number for 4,8-Dibromo-1-naphthoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4,8-dibromonaphthalene-1-carboxylic acid (CAS 42382-37-6) is a chemical compound with the molecular formula C11H6Br2O2 and a molecular weight of 329.97 g/mol. IUPAC name: 4,8-dibromonaphthalene-1-carboxylic acid. InChIKey: RISDXHGWPOMCET-UHFFFAOYSA-N.

Identity
Molecular formulaC11H6Br2O2
Molecular weight329.97 g/mol
IUPAC name4,8-dibromonaphthalene-1-carboxylic acid
InChIKeyRISDXHGWPOMCET-UHFFFAOYSA-N
SMILESC1=CC2=C(C=CC(=C2C(=C1)Br)C(=O)O)Br

Computed by PubChem (NCBI)