CAS 861087-06-1 is the registry number for 5,8-Dibromo-2-naphthoic Acid. Offered by: TRC. Available pack sizes: 500mg.
5,8-dibromonaphthalene-2-carboxylic acid (CAS 861087-06-1) is a chemical compound with the molecular formula C11H6Br2O2 and a molecular weight of 329.97 g/mol. IUPAC name: 5,8-dibromonaphthalene-2-carboxylic acid. InChIKey: FPHPAVIHQVCXQI-UHFFFAOYSA-N.
| Molecular formula | C11H6Br2O2 |
|---|---|
| Molecular weight | 329.97 g/mol |
| IUPAC name | 5,8-dibromonaphthalene-2-carboxylic acid |
| InChIKey | FPHPAVIHQVCXQI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2C=C1C(=O)O)Br)Br |
Computed by PubChem (NCBI)