Products 42448-56-6
CAS 42448-56-6 is the registry number for Pentamethylbenzene-1-thiol. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2,3,4,5,6-pentamethylbenzenethiol (CAS 42448-56-6) is a chemical compound with the molecular formula C11H16S and a molecular weight of 180.31 g/mol. IUPAC name: 2,3,4,5,6-pentamethylbenzenethiol. InChIKey: TZUPAWCZQMMBGH-UHFFFAOYSA-N.
| Molecular formula | C11H16S |
|---|---|
| Molecular weight | 180.31 g/mol |
| IUPAC name | 2,3,4,5,6-pentamethylbenzenethiol |
| InChIKey | TZUPAWCZQMMBGH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C)C)S)C)C |
Computed by PubChem (NCBI)