Products 7439-10-3

CAS 7439-10-3 is the registry number for tert-Butyl 4-Methylphenyl sulfide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

1-tert-butylsulfanyl-4-methylbenzene (CAS 7439-10-3) is a chemical compound with the molecular formula C11H16S and a molecular weight of 180.31 g/mol. IUPAC name: 1-tert-butylsulfanyl-4-methylbenzene. InChIKey: GPZPDHTYJTVKEO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16S
Molecular weight180.31 g/mol
IUPAC name1-tert-butylsulfanyl-4-methylbenzene
InChIKeyGPZPDHTYJTVKEO-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)SC(C)(C)C

Computed by PubChem (NCBI)