CAS 4245-77-6 is the registry number for N-Ethyl-N'-nitro-N-nitrosoguanidine (Technical Grade). Offered by: TRC. Available pack sizes: 1g.
1-ethyl-3-nitro-1-nitrosoguanidine (CAS 4245-77-6) is a chemical compound with the molecular formula C3H7N5O3 and a molecular weight of 161.12 g/mol. IUPAC name: 1-ethyl-3-nitro-1-nitrosoguanidine. InChIKey: ZGONASGBWOJHDD-UHFFFAOYSA-N.
| Molecular formula | C3H7N5O3 |
|---|---|
| Molecular weight | 161.12 g/mol |
| IUPAC name | 1-ethyl-3-nitro-1-nitrosoguanidine |
| InChIKey | ZGONASGBWOJHDD-UHFFFAOYSA-N |
| SMILES | CCN(C(=N)N[N+](=O)[O-])N=O |
Computed by PubChem (NCBI)