CAS 817177-66-5 is the registry number for 4–Amino–1–methyl–4H–1,2,4–triazol–1–ium nitrate. Offered by: GLPBio. Available pack sizes: 1g, 5g.
1-methyl-1,2,4-triazol-4-ium-4-amine nitrate (CAS 817177-66-5) is a chemical compound with the molecular formula C3H7N5O3 and a molecular weight of 161.12 g/mol. IUPAC name: 1-methyl-1,2,4-triazol-4-ium-4-amine nitrate. InChIKey: MJVRCMNTQOWYAH-UHFFFAOYSA-N.
| Molecular formula | C3H7N5O3 |
|---|---|
| Molecular weight | 161.12 g/mol |
| IUPAC name | 1-methyl-1,2,4-triazol-4-ium-4-amine nitrate |
| InChIKey | MJVRCMNTQOWYAH-UHFFFAOYSA-N |
| SMILES | CN1C=[N+](C=N1)N.[N+](=O)([O-])[O-] |
Computed by PubChem (NCBI)